C24H20N6O — CID 137315533
2-(methylamino)-5-[[8-(2-phenylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]phenol (PubChem CID 137315533) has the molecular formula C24H20N6O and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-(methylamino)-5-[[8-(2-phenylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]phenol.
| Compound Name | 2-(methylamino)-5-[[8-(2-phenylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 137315533 |
| Molecular Formula | C24H20N6O |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-(methylamino)-5-[[8-(2-phenylphenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]amino]phenol |
| SMILES | CNc1ccc(Nc2nc3c(-c4ccccc4-c4ccccc4)nccn3n2)cc1O |
| InChI | InChI=1S/C24H20N6O/c1-25-20-12-11-17(15-21(20)31)27-24-28-23-22(26-13-14-30(23)29-24)19-10-6-5-9-18(19)16-7-3-2-4-8-16/h2-15,25,31H,1H3,(H,27,29) |
| InChIKey | XAZLWFPZHVPUAZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|