C26H35ClN2O6 — CID 137315853
2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-[(E)-hydroxyiminomethyl]-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetic acid (PubChem CID 137315853) has the molecular formula C26H35ClN2O6 and a molecular weight of 507.03 g/mol. Its IUPAC name is 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-[(E)-hydroxyiminomethyl]-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-[(E)-hydroxyiminomethyl]-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 137315853 |
| Molecular Formula | C26H35ClN2O6 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-[(E)-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-3-[(E)-hydroxyiminomethyl]-6-methoxy-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]amino]oxyacetic acid |
| SMILES | COc1c(Cl)c(C)c(/C=N/O)c(O)c1C/C=C(C)/C=C/[C@@]1(C)[C@H](C)CC/C(=N\OCC(=O)O)[C@@H]1C |
| InChI | InChI=1S/C26H35ClN2O6/c1-15(7-9-19-24(32)20(13-28-33)17(3)23(27)25(19)34-6)11-12-26(5)16(2)8-10-21(18(26)4)29-35-14-22(30)31/h7,11-13,16,18,32-33H,8-10,14H2,1-6H3,(H,30,31)/b12-11+,15-7+,28-13+,29-21+/t16-,18+,26+/m1/s1 |
| InChIKey | QJTKYZJVDSUQSN-VKXJJTEDSA-N |
| XLogP | 5.75 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|