C6H10N2O2 — CID 137315895
(NE)-N-[(E,5E)-5-hydroxyiminohex-3-en-2-ylidene]hydroxylamine (PubChem CID 137315895) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is (NE)-N-[(E,5E)-5-hydroxyiminohex-3-en-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(E,5E)-5-hydroxyiminohex-3-en-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 137315895 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | (NE)-N-[(E,5E)-5-hydroxyiminohex-3-en-2-ylidene]hydroxylamine |
| SMILES | CC(/C=C/C(C)=N/O)=N\O |
| InChI | InChI=1S/C6H10N2O2/c1-5(7-9)3-4-6(2)8-10/h3-4,9-10H,1-2H3/b4-3+,7-5+,8-6+ |
| InChIKey | NFUVCWPAESVLQE-OKWWDJPNSA-N |
| XLogP | 1.24 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|