About 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate
1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate (PubChem CID 137315920) has the molecular formula C12H15F3N2O4
and a molecular weight of 308.26 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate |
| PubChem CID | 137315920 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate |
| SMILES | CCOC(=O)C(=[N+]=[N-])/C(=C\C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O4/c1-5-20-10(19)9(17-16)7(12(13,14)15)6-8(18)21-11(2,3)4/h6H,5H2,1-4H3/b7-6+ |
| InChIKey | HWIHITTXTRVZHE-VOTSOKGWSA-N |
| XLogP | 2.05 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate?
The IUPAC name of 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate (CID 137315920) is 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate is CCOC(=O)C(=[N+]=[N-])/C(=C\C(=O)OC(C)(C)C)C(F)(F)F.
What is the InChIKey of 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate?
The InChIKey is HWIHITTXTRVZHE-VOTSOKGWSA-N. The full InChI is InChI=1S/C12H15F3N2O4/c1-5-20-10(19)9(17-16)7(12(13,14)15)6-8(18)21-11(2,3)4/h6H,5H2,1-4H3/b7-6+.
What are the key properties of 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate?
1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate has a molecular weight of 308.26 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-ethyl (E)-4-diazo-3-(trifluoromethyl)pent-2-enedioate is sourced from PubChem (CID 137315920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).