C10H8F3N3O — CID 137316157
(2Z,4Z)-6,6,6-trifluoro-5-hydroxy-2-(5-methyl-1H-imidazol-2-yl)hexa-2,4-dienenitrile (PubChem CID 137316157) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is (2Z,4Z)-6,6,6-trifluoro-5-hydroxy-2-(5-methyl-1H-imidazol-2-yl)hexa-2,4-dienenitrile.
| Compound Name | (2Z,4Z)-6,6,6-trifluoro-5-hydroxy-2-(5-methyl-1H-imidazol-2-yl)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 137316157 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (2Z,4Z)-6,6,6-trifluoro-5-hydroxy-2-(5-methyl-1H-imidazol-2-yl)hexa-2,4-dienenitrile |
| SMILES | Cc1cnc(/C(C#N)=C\C=C(/O)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H8F3N3O/c1-6-5-15-9(16-6)7(4-14)2-3-8(17)10(11,12)13/h2-3,5,17H,1H3,(H,15,16)/b7-2-,8-3- |
| InChIKey | RHRGEETYBWIGBV-ZXCOBTLNSA-N |
| XLogP | 2.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|