About 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate
2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate (PubChem CID 137316260) has the molecular formula C15H13F3N2O3
and a molecular weight of 326.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate |
| PubChem CID | 137316260 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate |
| SMILES | C=C(C(C)=O)[C@@H](C(=[N+]=[N-])C(=O)OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O3/c1-9(10(2)21)12(11-6-4-3-5-7-11)13(20-19)14(22)23-8-15(16,17)18/h3-7,12H,1,8H2,2H3/t12-/m1/s1 |
| InChIKey | XJUXSKRSPBMKQA-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate?
The IUPAC name of 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate (CID 137316260) is 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate.
What is the SMILES notation for 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate?
The canonical SMILES for 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate is C=C(C(C)=O)[C@@H](C(=[N+]=[N-])C(=O)OCC(F)(F)F)c1ccccc1.
What is the InChIKey of 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate?
The InChIKey is XJUXSKRSPBMKQA-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H13F3N2O3/c1-9(10(2)21)12(11-6-4-3-5-7-11)13(20-19)14(22)23-8-15(16,17)18/h3-7,12H,1,8H2,2H3/t12-/m1/s1.
What are the key properties of 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate?
2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate has a molecular weight of 326.27 g/mol, XLogP of 2.69, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl (3S)-2-diazo-4-methylidene-5-oxo-3-phenylhexanoate is sourced from PubChem (CID 137316260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).