C23H26F2N8O2 — CID 137316409
N-[(1R,3S)-3-[[5-fluoro-2-[5-fluoro-2-[(E)-hydroxyiminomethyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide (PubChem CID 137316409) has the molecular formula C23H26F2N8O2 and a molecular weight of 484.51 g/mol. Its IUPAC name is N-[(1R,3S)-3-[[5-fluoro-2-[5-fluoro-2-[(E)-hydroxyiminomethyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(1R,3S)-3-[[5-fluoro-2-[5-fluoro-2-[(E)-hydroxyiminomethyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 137316409 |
| Molecular Formula | C23H26F2N8O2 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[(1R,3S)-3-[[5-fluoro-2-[5-fluoro-2-[(E)-hydroxyiminomethyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@H](Nc2nc(-c3c(/C=N/O)[nH]c4ncc(F)cc34)ncc2F)C1)N1CCCC1 |
| InChI | InChI=1S/C23H26F2N8O2/c24-13-8-16-19(18(12-28-35)31-20(16)26-10-13)22-27-11-17(25)21(32-22)29-14-4-3-5-15(9-14)30-23(34)33-6-1-2-7-33/h8,10-12,14-15,35H,1-7,9H2,(H,26,31)(H,30,34)(H,27,29,32)/b28-12+/t14-,15+/m0/s1 |
| InChIKey | NLHRSGXDAVTZPQ-QWSUDGKYSA-N |
| XLogP | 3.63 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|