C14H11F3N4O2S — CID 137316619
1-[1-(4-sulfanylphenyl)ethyl]-3-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione (PubChem CID 137316619) has the molecular formula C14H11F3N4O2S and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-[1-(4-sulfanylphenyl)ethyl]-3-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione.
| Compound Name | 1-[1-(4-sulfanylphenyl)ethyl]-3-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 137316619 |
| Molecular Formula | C14H11F3N4O2S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-[1-(4-sulfanylphenyl)ethyl]-3-(trifluoromethyl)-7H-pyrazolo[5,4-d]pyrimidine-4,6-dione |
| SMILES | CC(c1ccc(S)cc1)n1nc(C(F)(F)F)c2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C14H11F3N4O2S/c1-6(7-2-4-8(24)5-3-7)21-11-9(10(20-21)14(15,16)17)12(22)19-13(23)18-11/h2-6,24H,1H3,(H2,18,19,22,23) |
| InChIKey | IQEOFQJPWWNLPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|