C32H31ClN3NaO5S — CID 137316683
sodium 6-[5-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-chlorophenoxy]hexane-1-sulfonate (PubChem CID 137316683) has the molecular formula C32H31ClN3NaO5S and a molecular weight of 628.13 g/mol. Its IUPAC name is sodium 6-[5-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-chlorophenoxy]hexane-1-sulfonate.
| Compound Name | sodium 6-[5-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-chlorophenoxy]hexane-1-sulfonate |
|---|---|
| PubChem CID | 137316683 |
| Molecular Formula | C32H31ClN3NaO5S |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | sodium 6-[5-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-chlorophenoxy]hexane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCCCOc1cc(Cc2nc3c(Cc4ccccc4)nc(-c4ccccc4)cn3c2O)ccc1Cl.[Na+] |
| InChI | InChI=1S/C32H32ClN3O5S.Na/c33-26-16-15-24(21-30(26)41-17-9-1-2-10-18-42(38,39)40)20-28-32(37)36-22-29(25-13-7-4-8-14-25)34-27(31(36)35-28)19-23-11-5-3-6-12-23;/h3-8,11-16,21-22,37H,1-2,9-10,17-20H2,(H,38,39,40);/q;+1/p-1 |
| InChIKey | QRJCCOMIYDOPKO-UHFFFAOYSA-M |
| XLogP | 3.43 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|