C20H13N5OS2 — CID 137317303
5-(5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazin-6-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 137317303) has the molecular formula C20H13N5OS2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 5-(5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazin-6-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazin-6-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 137317303 |
| Molecular Formula | C20H13N5OS2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 5-(5-hydroxy-3,4-diphenylthieno[2,3-c]pyridazin-6-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Oc1c(-c2nc(=S)[nH][nH]2)sc2nnc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H13N5OS2/c26-16-14-13(11-7-3-1-4-8-11)15(12-9-5-2-6-10-12)22-24-19(14)28-17(16)18-21-20(27)25-23-18/h1-10,26H,(H2,21,23,25,27) |
| InChIKey | TVWOACXRUIIWDI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|