About 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol
3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol (PubChem CID 137317513) has the molecular formula C23H14ClN5O3
and a molecular weight of 443.85 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol |
| PubChem CID | 137317513 |
| Molecular Formula | C23H14ClN5O3 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(Cl)cc2c1/N=N/c1nc(-c2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C23H14ClN5O3/c24-13-6-7-17-15(10-13)20(23(30)26-17)28-29-22-14-3-1-2-4-16(14)25-21(27-22)12-5-8-18-19(9-12)32-11-31-18/h1-10,26,30H,11H2/b29-28+ |
| InChIKey | YRHNHZQRTMGYQA-ZQHSETAFSA-N |
| XLogP | 6.28 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol?
The IUPAC name of 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol (CID 137317513) is 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol.
What is the SMILES notation for 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol?
The canonical SMILES for 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol is Oc1[nH]c2ccc(Cl)cc2c1/N=N/c1nc(-c2ccc3c(c2)OCO3)nc2ccccc12.
What is the InChIKey of 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol?
The InChIKey is YRHNHZQRTMGYQA-ZQHSETAFSA-N. The full InChI is InChI=1S/C23H14ClN5O3/c24-13-6-7-17-15(10-13)20(23(30)26-17)28-29-22-14-3-1-2-4-16(14)25-21(27-22)12-5-8-18-19(9-12)32-11-31-18/h1-10,26,30H,11H2/b29-28+.
What are the key properties of 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol?
3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol has a molecular weight of 443.85 g/mol, XLogP of 6.28, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(1,3-benzodioxol-5-yl)quinazolin-4-yl]diazenyl]-5-chloro-1H-indol-2-ol is sourced from PubChem (CID 137317513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).