About 3-chloro-N,N-dimethylbut-2-enamide
3-chloro-N,N-dimethylbut-2-enamide (PubChem CID 137318656) has the molecular formula C6H10ClNO
and a molecular weight of 147.60 g/mol. Its IUPAC name is 3-chloro-N,N-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | 3-chloro-N,N-dimethylbut-2-enamide |
| PubChem CID | 137318656 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 3-chloro-N,N-dimethylbut-2-enamide |
| SMILES | CC(Cl)=CC(=O)N(C)C |
| InChI | InChI=1S/C6H10ClNO/c1-5(7)4-6(9)8(2)3/h4H,1-3H3 |
| InChIKey | CQWMSAMHZQWPQK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N,N-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-dimethylbut-2-enamide?
The IUPAC name of 3-chloro-N,N-dimethylbut-2-enamide (CID 137318656) is 3-chloro-N,N-dimethylbut-2-enamide.
What is the SMILES notation for 3-chloro-N,N-dimethylbut-2-enamide?
The canonical SMILES for 3-chloro-N,N-dimethylbut-2-enamide is CC(Cl)=CC(=O)N(C)C.
What is the InChIKey of 3-chloro-N,N-dimethylbut-2-enamide?
The InChIKey is CQWMSAMHZQWPQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClNO/c1-5(7)4-6(9)8(2)3/h4H,1-3H3.
What are the key properties of 3-chloro-N,N-dimethylbut-2-enamide?
3-chloro-N,N-dimethylbut-2-enamide has a molecular weight of 147.60 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-dimethylbut-2-enamide is sourced from PubChem (CID 137318656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).