About 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide
5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide (PubChem CID 137320310) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide |
| PubChem CID | 137320310 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide |
| SMILES | Cc1ocnc1C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C11H11N3O2/c1-8-10(12-7-16-8)11(15)14-13-9-5-3-2-4-6-9/h2-7,13H,1H3,(H,14,15) |
| InChIKey | RGISVZROEOFEFR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide?
The IUPAC name of 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide (CID 137320310) is 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide.
What is the SMILES notation for 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide?
The canonical SMILES for 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide is Cc1ocnc1C(=O)NNc1ccccc1.
What is the InChIKey of 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide?
The InChIKey is RGISVZROEOFEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c1-8-10(12-7-16-8)11(15)14-13-9-5-3-2-4-6-9/h2-7,13H,1H3,(H,14,15).
What are the key properties of 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide?
5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide has a molecular weight of 217.23 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N'-phenyl-1,3-oxazole-4-carbohydrazide is sourced from PubChem (CID 137320310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).