C10H14O4 — CID 137321634
[(1S,3aS,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate (PubChem CID 137321634) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is [(1S,3aS,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate.
| Compound Name | [(1S,3aS,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate |
|---|---|
| PubChem CID | 137321634 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [(1S,3aS,7aR)-5-oxo-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC[C@H]2CC(=O)CC[C@H]21 |
| InChI | InChI=1S/C10H14O4/c1-6(11)14-10-9-3-2-8(12)4-7(9)5-13-10/h7,9-10H,2-5H2,1H3/t7-,9-,10+/m1/s1 |
| InChIKey | CILGVGOKARPOSJ-QNSHHTMESA-N |
| XLogP | 0.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |