C14H24O3Si — CID 137321649
(3aS,7aR)-5-[tert-butyl(dimethyl)silyl]oxy-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 137321649) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is (3aS,7aR)-5-[tert-butyl(dimethyl)silyl]oxy-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3aS,7aR)-5-[tert-butyl(dimethyl)silyl]oxy-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 137321649 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (3aS,7aR)-5-[tert-butyl(dimethyl)silyl]oxy-3a,6,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@@H]2COC(=O)[C@@H]2CC1 |
| InChI | InChI=1S/C14H24O3Si/c1-14(2,3)18(4,5)17-11-6-7-12-10(8-11)9-16-13(12)15/h8,10,12H,6-7,9H2,1-5H3/t10-,12-/m1/s1 |
| InChIKey | IVANWRPIQLKWIE-ZYHUDNBSSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|