C9H8N2O2 — CID 4723
View drug profile → pemoline2-amino-5-phenyl-1,3-oxazol-4-one (PubChem CID 4723) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-amino-5-phenyl-1,3-oxazol-4-one.
| Compound Name | 2-amino-5-phenyl-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 4723 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-amino-5-phenyl-1,3-oxazol-4-one |
| SMILES | NC1=NC(=O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C9H8N2O2/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12) |
| InChIKey | NRNCYVBFPDDJNE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |