About magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide
magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide (PubChem CID 137321692) has the molecular formula C9H10MgN2O4
and a molecular weight of 234.49 g/mol. Its IUPAC name is magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide.
Molecular Properties
| Compound Name | magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide |
| PubChem CID | 137321692 |
| Molecular Formula | C9H10MgN2O4 |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide |
| SMILES | [H]/N=C1/NC(=O)C(c2ccccc2)O1.[Mg+2].[OH-].[OH-] |
| InChI | InChI=1S/C9H8N2O2.Mg.2H2O/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6;;;/h1-5,7H,(H2,10,11,12);;2*1H2/q;+2;;/p-2 |
| InChIKey | JOPOQPCBCUIPFX-UHFFFAOYSA-L |
| XLogP | 0.07 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide?
The IUPAC name of magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide (CID 137321692) is magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide.
What is the SMILES notation for magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide?
The canonical SMILES for magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide is [H]/N=C1/NC(=O)C(c2ccccc2)O1.[Mg+2].[OH-].[OH-].
What is the InChIKey of magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide?
The InChIKey is JOPOQPCBCUIPFX-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H8N2O2.Mg.2H2O/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6;;;/h1-5,7H,(H2,10,11,12);;2*1H2/q;+2;;/p-2.
What are the key properties of magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide?
magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide has a molecular weight of 234.49 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-imino-5-phenyl-1,3-oxazolidin-4-one;dihydroxide is sourced from PubChem (CID 137321692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).