C26H18O12 — CID 137321735
methyl (2S)-5',8',10-trihydroxy-7'-methoxy-4',9,9'-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate (PubChem CID 137321735) has the molecular formula C26H18O12 and a molecular weight of 522.42 g/mol. Its IUPAC name is methyl (2S)-5',8',10-trihydroxy-7'-methoxy-4',9,9'-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate.
| Compound Name | methyl (2S)-5',8',10-trihydroxy-7'-methoxy-4',9,9'-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate |
|---|---|
| PubChem CID | 137321735 |
| Molecular Formula | C26H18O12 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | methyl (2S)-5',8',10-trihydroxy-7'-methoxy-4',9,9'-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate |
| SMILES | COC(=O)c1cc2cc3c(c(O)c2c(=O)o1)O[C@]1(CC3)CC2=C(O1)C(=O)c1c(O)c(OC)cc(O)c1C2=O |
| InChI | InChI=1S/C26H18O12/c1-34-13-7-12(27)16-17(19(13)29)21(31)23-11(18(16)28)8-26(38-23)4-3-9-5-10-6-14(24(32)35-2)36-25(33)15(10)20(30)22(9)37-26/h5-7,27,29-30H,3-4,8H2,1-2H3/t26-/m0/s1 |
| InChIKey | YAAXPWOYJHVDKS-SANMLTNESA-N |
| XLogP | 2.48 |
| TPSA | 179.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|