C21H18O3 — CID 137325610
(1S,2S,4R,8S,10S,11R)-1-methyl-11-phenyl-13-oxaheptacyclo[9.3.1.02,10.04,8.05,14.07,12.012,14]pentadecane-3,9-dione (PubChem CID 137325610) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is (1S,2S,4R,8S,10S,11R)-1-methyl-11-phenyl-13-oxaheptacyclo[9.3.1.02,10.04,8.05,14.07,12.012,14]pentadecane-3,9-dione.
| Compound Name | (1S,2S,4R,8S,10S,11R)-1-methyl-11-phenyl-13-oxaheptacyclo[9.3.1.02,10.04,8.05,14.07,12.012,14]pentadecane-3,9-dione |
|---|---|
| PubChem CID | 137325610 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (1S,2S,4R,8S,10S,11R)-1-methyl-11-phenyl-13-oxaheptacyclo[9.3.1.02,10.04,8.05,14.07,12.012,14]pentadecane-3,9-dione |
| SMILES | C[C@]12C[C@]3(c4ccccc4)[C@H]4C(=O)[C@H]5C6CC([C@H]5C(=O)[C@@H]41)C21OC613 |
| InChI | InChI=1S/C21H18O3/c1-18-8-19(9-5-3-2-4-6-9)15-14(18)16(22)12-10-7-11(13(12)17(15)23)21(19)20(10,18)24-21/h2-6,10-15H,7-8H2,1H3/t10?,11?,12-,13+,14-,15-,18+,19+,20?,21?/m1/s1 |
| InChIKey | AQFXAPYVJXETBZ-DSXMKNGSSA-N |
| XLogP | 2.14 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|