C25H32O4S — CID 137325787
S-[(2S,5'R,7'S,11'R)-7',11'-dimethyl-5,14'-dioxospiro[oxolane-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-18'-yl] ethanethioate (PubChem CID 137325787) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is S-[(2S,5'R,7'S,11'R)-7',11'-dimethyl-5,14'-dioxospiro[oxolane-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-18'-yl] ethanethioate.
| Compound Name | S-[(2S,5'R,7'S,11'R)-7',11'-dimethyl-5,14'-dioxospiro[oxolane-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-18'-yl] ethanethioate |
|---|---|
| PubChem CID | 137325787 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | S-[(2S,5'R,7'S,11'R)-7',11'-dimethyl-5,14'-dioxospiro[oxolane-2,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-18'-yl] ethanethioate |
| SMILES | CC(=O)SC1CC2=CC(=O)CC[C@]2(C)C2CC[C@@]3(C)C(C12)C1C[C@H]1[C@@]31CCC(=O)O1 |
| InChI | InChI=1S/C25H32O4S/c1-13(26)30-19-11-14-10-15(27)4-7-23(14,2)17-5-8-24(3)22(21(17)19)16-12-18(16)25(24)9-6-20(28)29-25/h10,16-19,21-22H,4-9,11-12H2,1-3H3/t16?,17?,18-,19?,21?,22?,23+,24+,25+/m1/s1 |
| InChIKey | XOWMGPADTDPJHZ-JGUGULNASA-N |
| XLogP | 4.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|