C17H23FO — CID 137326487
(2R,4S,4aR,7R,8aR)-4-fluoro-4,7-dimethyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 137326487) has the molecular formula C17H23FO and a molecular weight of 262.37 g/mol. Its IUPAC name is (2R,4S,4aR,7R,8aR)-4-fluoro-4,7-dimethyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | (2R,4S,4aR,7R,8aR)-4-fluoro-4,7-dimethyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 137326487 |
| Molecular Formula | C17H23FO |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2R,4S,4aR,7R,8aR)-4-fluoro-4,7-dimethyl-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](c1ccccc1)C[C@]2(C)F |
| InChI | InChI=1S/C17H23FO/c1-12-8-9-14-15(10-12)19-16(11-17(14,2)18)13-6-4-3-5-7-13/h3-7,12,14-16H,8-11H2,1-2H3/t12-,14-,15-,16-,17+/m1/s1 |
| InChIKey | GZGIJAWXTUIJPR-NHMWIVBRSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |