C27H34O10 — CID 137326639
CID 137326639 (PubChem CID 137326639) has the molecular formula C27H34O10 and a molecular weight of 518.56 g/mol.
| Compound Name | CID 137326639 |
|---|---|
| PubChem CID | 137326639 |
| Molecular Formula | C27H34O10 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1O[C@@]12[C@](C)(C(=O)c1ccoc1)CCC1[C@@H](C)OC3(OC4CC(=O)OC(C)(C)C4C3O)[C@]12C |
| InChI | InChI=1S/C27H34O10/c1-13-15-7-9-24(4,19(29)14-8-10-33-12-14)26(21(37-26)22(31)32-6)25(15,5)27(34-13)20(30)18-16(35-27)11-17(28)36-23(18,2)3/h8,10,12-13,15-16,18,20-21,30H,7,9,11H2,1-6H3/t13-,15?,16?,18?,20?,21+,24+,25-,26-,27?/m1/s1 |
| InChIKey | XDGKUEYAPOSPHF-HGIRFSONSA-N |
| XLogP | 2.41 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|