C20H35O6PSi2 — CID 137328215
[2-[2,2-dimethyl-3,3-bis(methylsilyloxy)propyl]phenyl]methyl bis(prop-2-enyl) phosphate (PubChem CID 137328215) has the molecular formula C20H35O6PSi2 and a molecular weight of 458.64 g/mol. Its IUPAC name is [2-[2,2-dimethyl-3,3-bis(methylsilyloxy)propyl]phenyl]methyl bis(prop-2-enyl) phosphate.
| Compound Name | [2-[2,2-dimethyl-3,3-bis(methylsilyloxy)propyl]phenyl]methyl bis(prop-2-enyl) phosphate |
|---|---|
| PubChem CID | 137328215 |
| Molecular Formula | C20H35O6PSi2 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [2-[2,2-dimethyl-3,3-bis(methylsilyloxy)propyl]phenyl]methyl bis(prop-2-enyl) phosphate |
| SMILES | C=CCOP(=O)(OCC=C)OCc1ccccc1CC(C)(C)C(O[SiH2]C)O[SiH2]C |
| InChI | InChI=1S/C20H35O6PSi2/c1-7-13-22-27(21,23-14-8-2)24-16-18-12-10-9-11-17(18)15-20(3,4)19(25-28-5)26-29-6/h7-12,19H,1-2,13-16,28-29H2,3-6H3 |
| InChIKey | WCAXKMMGKGTNBQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|