C32H23F6N2O2+ — CID 137328351
(4Z)-2-[1-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-3-hydroxy-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 137328351) has the molecular formula C32H23F6N2O2+ and a molecular weight of 581.54 g/mol. Its IUPAC name is (4Z)-2-[1-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-3-hydroxy-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | (4Z)-2-[1-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-3-hydroxy-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 137328351 |
| Molecular Formula | C32H23F6N2O2+ |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | (4Z)-2-[1-[3,5-bis(trifluoromethyl)phenyl]indol-3-yl]-3-hydroxy-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | C[N+]1=C(/C=C2\C(=O)C(c3cn(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4ccccc34)=C2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C32H22F6N2O2/c1-30(2)23-9-5-7-11-25(23)39(3)26(30)15-21-28(41)27(29(21)42)22-16-40(24-10-6-4-8-20(22)24)19-13-17(31(33,34)35)12-18(14-19)32(36,37)38/h4-16H,1-3H3/p+1 |
| InChIKey | LCLYZPPPWRDIIM-UHFFFAOYSA-O |
| XLogP | 8.15 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|