C31H40N3O2Si- — CID 137328510
5-(4-silyl-4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylbutyl)tricyclo[7.2.1.02,8]dodecane-3,6-dione (PubChem CID 137328510) has the molecular formula C31H40N3O2Si- and a molecular weight of 514.77 g/mol. Its IUPAC name is 5-(4-silyl-4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylbutyl)tricyclo[7.2.1.02,8]dodecane-3,6-dione.
| Compound Name | 5-(4-silyl-4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylbutyl)tricyclo[7.2.1.02,8]dodecane-3,6-dione |
|---|---|
| PubChem CID | 137328510 |
| Molecular Formula | C31H40N3O2Si- |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 5-(4-silyl-4-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylbutyl)tricyclo[7.2.1.02,8]dodecane-3,6-dione |
| SMILES | O=C1CC2C3CCC(C3)C2C(=O)CC1CC[CH-]C([SiH3])N1CCC2(CC1)Nc1ccccc1-n1cccc12 |
| InChI | InChI=1S/C31H40N3O2Si/c35-26-19-23-20-10-11-22(17-20)30(23)27(36)18-21(26)5-3-9-29(37)33-15-12-31(13-16-33)28-8-4-14-34(28)25-7-2-1-6-24(25)32-31/h1-2,4,6-9,14,20-23,29-30,32H,3,5,10-13,15-19H2,37H3/q-1 |
| InChIKey | PSGVSXQSDMXRNP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|