C17H28O4Si2 — CID 137329955
1-[4-[3-(disilanyl)propoxy]-3-methoxyphenyl]-4,4-dimethylpentane-1,3-dione (PubChem CID 137329955) has the molecular formula C17H28O4Si2 and a molecular weight of 352.58 g/mol. Its IUPAC name is 1-[4-[3-(disilanyl)propoxy]-3-methoxyphenyl]-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-[4-[3-(disilanyl)propoxy]-3-methoxyphenyl]-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 137329955 |
| Molecular Formula | C17H28O4Si2 |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[4-[3-(disilanyl)propoxy]-3-methoxyphenyl]-4,4-dimethylpentane-1,3-dione |
| SMILES | COc1cc(C(=O)CC(=O)C(C)(C)C)ccc1OCCC[SiH2][SiH3] |
| InChI | InChI=1S/C17H28O4Si2/c1-17(2,3)16(19)11-13(18)12-6-7-14(15(10-12)20-4)21-8-5-9-23-22/h6-7,10H,5,8-9,11,23H2,1-4,22H3 |
| InChIKey | IUZQARCXSDNZIL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|