C25H31N3O2Si — CID 137330563
4-(5-dimethylsilyl-2-propoxyphenyl)-6-(1-imino-3-methyliminopropan-2-yl)-2-methylisoquinolin-1-one (PubChem CID 137330563) has the molecular formula C25H31N3O2Si and a molecular weight of 433.63 g/mol. Its IUPAC name is 4-(5-dimethylsilyl-2-propoxyphenyl)-6-(1-imino-3-methyliminopropan-2-yl)-2-methylisoquinolin-1-one.
| Compound Name | 4-(5-dimethylsilyl-2-propoxyphenyl)-6-(1-imino-3-methyliminopropan-2-yl)-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 137330563 |
| Molecular Formula | C25H31N3O2Si |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-(5-dimethylsilyl-2-propoxyphenyl)-6-(1-imino-3-methyliminopropan-2-yl)-2-methylisoquinolin-1-one |
| SMILES | [H]/N=C/C(/C=N/C)c1ccc2c(=O)n(C)cc(-c3cc([SiH](C)C)ccc3OCCC)c2c1 |
| InChI | InChI=1S/C25H31N3O2Si/c1-6-11-30-24-10-8-19(31(4)5)13-22(24)23-16-28(3)25(29)20-9-7-17(12-21(20)23)18(14-26)15-27-2/h7-10,12-16,18,26,31H,6,11H2,1-5H3/b26-14+,27-15+ |
| InChIKey | LFZYVGILKTXBMG-CIOBDNPFSA-N |
| XLogP | 4.12 |
| TPSA | 67.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|