C9H20N4OSi2 — CID 137330743
4-[[ethyl(hydroxy)silyl]methyl]-N-trimethylsilyl-1,3,5-triazin-2-amine (PubChem CID 137330743) has the molecular formula C9H20N4OSi2 and a molecular weight of 256.46 g/mol. Its IUPAC name is 4-[[ethyl(hydroxy)silyl]methyl]-N-trimethylsilyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[[ethyl(hydroxy)silyl]methyl]-N-trimethylsilyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 137330743 |
| Molecular Formula | C9H20N4OSi2 |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-[[ethyl(hydroxy)silyl]methyl]-N-trimethylsilyl-1,3,5-triazin-2-amine |
| SMILES | CC[SiH](O)Cc1ncnc(N[Si](C)(C)C)n1 |
| InChI | InChI=1S/C9H20N4OSi2/c1-5-15(14)6-8-10-7-11-9(12-8)13-16(2,3)4/h7,14-15H,5-6H2,1-4H3,(H,10,11,12,13) |
| InChIKey | DZKZNQQRFKJMFG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|