C10H16ClNSi — CID 137331040
1-[2-[chloro(methyl)silyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 137331040) has the molecular formula C10H16ClNSi and a molecular weight of 213.78 g/mol. Its IUPAC name is 1-[2-[chloro(methyl)silyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[chloro(methyl)silyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 137331040 |
| Molecular Formula | C10H16ClNSi |
| Molecular Weight | 213.78 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 1-[2-[chloro(methyl)silyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1[SiH](C)Cl |
| InChI | InChI=1S/C10H16ClNSi/c1-12(2)8-9-6-4-5-7-10(9)13(3)11/h4-7,13H,8H2,1-3H3 |
| InChIKey | LPYOCGFGGFBDBR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.78 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|