C40H66O — CID 137331533
(2S,3R)-2-[(5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-5,7-dienyl]-3-[(E)-2,6-dimethyl-8-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]oct-1-enyl]oxirane (PubChem CID 137331533) has the molecular formula C40H66O and a molecular weight of 562.97 g/mol. Its IUPAC name is (2S,3R)-2-[(5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-5,7-dienyl]-3-[(E)-2,6-dimethyl-8-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]oct-1-enyl]oxirane.
| Compound Name | (2S,3R)-2-[(5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-5,7-dienyl]-3-[(E)-2,6-dimethyl-8-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]oct-1-enyl]oxirane |
|---|---|
| PubChem CID | 137331533 |
| Molecular Formula | C40H66O |
| Molecular Weight | 562.97 g/mol |
| Exact Mass | 562.51 |
| IUPAC Name | (2S,3R)-2-[(5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-5,7-dienyl]-3-[(E)-2,6-dimethyl-8-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]oct-1-enyl]oxirane |
| SMILES | CC1=CCCC(C)(C)[C@H]1CCC(C)CCC/C(C)=C/[C@H]1O[C@H]1CC(C)CC/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H66O/c1-29(21-23-35-33(5)19-13-25-39(35,7)8)15-11-17-31(3)27-37-38(41-37)28-32(4)18-12-16-30(2)22-24-36-34(6)20-14-26-40(36,9)10/h15,20-21,23,28,30-31,36-38H,11-14,16-19,22,24-27H2,1-10H3/b23-21+,29-15+,32-28+/t30?,31?,36-,37-,38+/m0/s1 |
| InChIKey | JQIVRVTYZUPKMX-HHHWUHHUSA-N |
| XLogP | 12.50 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.97 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|