C40H62O — CID 137331574
[(1R)-1,3-dimethyl-2-[(1E,3E,5E,7E,9E,11E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,7,9,11-hexaenyl]cyclohex-2-en-1-yl]methanol (PubChem CID 137331574) has the molecular formula C40H62O and a molecular weight of 558.94 g/mol. Its IUPAC name is [(1R)-1,3-dimethyl-2-[(1E,3E,5E,7E,9E,11E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,7,9,11-hexaenyl]cyclohex-2-en-1-yl]methanol.
| Compound Name | [(1R)-1,3-dimethyl-2-[(1E,3E,5E,7E,9E,11E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,7,9,11-hexaenyl]cyclohex-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 137331574 |
| Molecular Formula | C40H62O |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.48 |
| IUPAC Name | [(1R)-1,3-dimethyl-2-[(1E,3E,5E,7E,9E,11E)-3,7,12,16-tetramethyl-18-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]octadeca-1,3,5,7,9,11-hexaenyl]cyclohex-2-en-1-yl]methanol |
| SMILES | CC1=CCCC(C)(C)[C@H]1CCC(C)CCC/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCC[C@@]1(C)CO |
| InChI | InChI=1S/C40H62O/c1-31(18-12-20-33(3)24-26-37-35(5)22-14-28-39(37,7)8)16-10-11-17-32(2)19-13-21-34(4)25-27-38-36(6)23-15-29-40(38,9)30-41/h10-11,13,16-17,19,21-22,25,27,33,37,41H,12,14-15,18,20,23-24,26,28-30H2,1-9H3/b11-10+,19-13+,27-25+,31-16+,32-17+,34-21+/t33?,37-,40-/m0/s1 |
| InChIKey | JKPIWTLMUSYPSE-ZSIUKMLPSA-N |
| XLogP | 11.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|