About propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate
propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate (PubChem CID 137331633) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate |
| PubChem CID | 137331633 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate |
| SMILES | C=CC1OCOC(C)C1C(=O)OC(C)C |
| InChI | InChI=1S/C11H18O4/c1-5-9-10(8(4)13-6-14-9)11(12)15-7(2)3/h5,7-10H,1,6H2,2-4H3 |
| InChIKey | XPUXOVHLPXAOLW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate?
The IUPAC name of propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate (CID 137331633) is propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate.
What is the SMILES notation for propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate?
The canonical SMILES for propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate is C=CC1OCOC(C)C1C(=O)OC(C)C.
What is the InChIKey of propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate?
The InChIKey is XPUXOVHLPXAOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-5-9-10(8(4)13-6-14-9)11(12)15-7(2)3/h5,7-10H,1,6H2,2-4H3.
What are the key properties of propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate?
propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate has a molecular weight of 214.26 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-ethenyl-6-methyl-1,3-dioxane-5-carboxylate is sourced from PubChem (CID 137331633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).