About 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid
6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 137331639) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 137331639 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCC1=CC(O)(C(C)(C)C)C(C(=O)O)C=C1 |
| InChI | InChI=1S/C13H20O3/c1-5-9-6-7-10(11(14)15)13(16,8-9)12(2,3)4/h6-8,10,16H,5H2,1-4H3,(H,14,15) |
| InChIKey | VACZOCUJYDCCRD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 137331639) is 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid is CCC1=CC(O)(C(C)(C)C)C(C(=O)O)C=C1.
What is the InChIKey of 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is VACZOCUJYDCCRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-5-9-6-7-10(11(14)15)13(16,8-9)12(2,3)4/h6-8,10,16H,5H2,1-4H3,(H,14,15).
What are the key properties of 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 224.30 g/mol, XLogP of 2.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-4-ethyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 137331639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).