C23H26O9 — CID 137333799
7,8-dimethoxy-2-phenyl-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one (PubChem CID 137333799) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is 7,8-dimethoxy-2-phenyl-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one.
| Compound Name | 7,8-dimethoxy-2-phenyl-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 137333799 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 7,8-dimethoxy-2-phenyl-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(O[C@@H]2OC(C)[C@H](O)[C@H](O)C2O)c2c(c1OC)OC(c1ccccc1)CC2=O |
| InChI | InChI=1S/C23H26O9/c1-11-18(25)19(26)20(27)23(30-11)32-15-10-16(28-2)21(29-3)22-17(15)13(24)9-14(31-22)12-7-5-4-6-8-12/h4-8,10-11,14,18-20,23,25-27H,9H2,1-3H3/t11?,14?,18-,19-,20?,23-/m0/s1 |
| InChIKey | VPGZAAVNFQFLSM-KFPSXWOYSA-N |
| XLogP | 1.62 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |