About [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium
[(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium (PubChem CID 137333878) has the molecular formula C9H15N2O2+
and a molecular weight of 183.23 g/mol. Its IUPAC name is [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium.
Molecular Properties
| Compound Name | [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium |
| PubChem CID | 137333878 |
| Molecular Formula | C9H15N2O2+ |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium |
| SMILES | Nc1ccc([C@@H](O)[C@H]([NH3+])CO)cc1 |
| InChI | InChI=1S/C9H14N2O2/c10-7-3-1-6(2-4-7)9(13)8(11)5-12/h1-4,8-9,12-13H,5,10-11H2/p+1/t8-,9-/m1/s1 |
| InChIKey | HOSHJSFGXZIFCZ-RKDXNWHRSA-O |
| XLogP | -1.10 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium?
The IUPAC name of [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium (CID 137333878) is [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium.
What is the SMILES notation for [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium?
The canonical SMILES for [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium is Nc1ccc([C@@H](O)[C@H]([NH3+])CO)cc1.
What is the InChIKey of [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium?
The InChIKey is HOSHJSFGXZIFCZ-RKDXNWHRSA-O. The full InChI is InChI=1S/C9H14N2O2/c10-7-3-1-6(2-4-7)9(13)8(11)5-12/h1-4,8-9,12-13H,5,10-11H2/p+1/t8-,9-/m1/s1.
What are the key properties of [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium?
[(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium has a molecular weight of 183.23 g/mol, XLogP of -1.10, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium is sourced from PubChem (CID 137333878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).