C9H15N2O2+ — CID 137333878
[(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium (PubChem CID 137333878) has the molecular formula C9H15N2O2+ and a molecular weight of 183.23 g/mol. Its IUPAC name is [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium.
| Compound Name | [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium |
|---|---|
| PubChem CID | 137333878 |
| Molecular Formula | C9H15N2O2+ |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | [(1R,2R)-1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]azanium |
| SMILES | Nc1ccc([C@@H](O)[C@H]([NH3+])CO)cc1 |
| InChI | InChI=1S/C9H14N2O2/c10-7-3-1-6(2-4-7)9(13)8(11)5-12/h1-4,8-9,12-13H,5,10-11H2/p+1/t8-,9-/m1/s1 |
| InChIKey | HOSHJSFGXZIFCZ-RKDXNWHRSA-O |
| XLogP | -1.10 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|