C10H17O10- — CID 137333910
(2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoate (PubChem CID 137333910) has the molecular formula C10H17O10- and a molecular weight of 297.24 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoate.
| Compound Name | (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 137333910 |
| Molecular Formula | C10H17O10- |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanoate |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O10/c11-1-4(6(14)7(15)9(17)18)20-10-8(16)5(13)3(12)2-19-10/h3-8,10-16H,1-2H2,(H,17,18)/p-1/t3-,4-,5+,6+,7-,8-,10+/m1/s1 |
| InChIKey | DGXURXUMSDNLNT-LGPZGGMRSA-M |
| XLogP | -5.73 |
| TPSA | 179.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |