C15H25O14- — CID 137333912
(2R,3R,4R)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trihydroxypentanoate (PubChem CID 137333912) has the molecular formula C15H25O14- and a molecular weight of 429.35 g/mol. Its IUPAC name is (2R,3R,4R)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trihydroxypentanoate.
| Compound Name | (2R,3R,4R)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trihydroxypentanoate |
|---|---|
| PubChem CID | 137333912 |
| Molecular Formula | C15H25O14- |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (2R,3R,4R)-4-[(2S,3R,4R,5R)-3,4-dihydroxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2,3,5-trihydroxypentanoate |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1OC[C@@H](O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H26O14/c16-1-5(8(19)10(21)13(24)25)28-15-12(23)9(20)6(3-27-15)29-14-11(22)7(18)4(17)2-26-14/h4-12,14-23H,1-3H2,(H,24,25)/p-1/t4-,5-,6-,7+,8+,9+,10-,11-,12-,14+,15+/m1/s1 |
| InChIKey | BVISSQNVOKXBRV-WKURFPTNSA-M |
| XLogP | -7.26 |
| TPSA | 238.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | -7.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |