C14H18FN5O2 — CID 137334187
N-[2-[[5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-4-fluorobenzamide (PubChem CID 137334187) has the molecular formula C14H18FN5O2 and a molecular weight of 307.33 g/mol. Its IUPAC name is N-[2-[[5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 137334187 |
| Molecular Formula | C14H18FN5O2 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-[2-[[5-[(dimethylamino)methyl]-1,3,4-oxadiazol-2-yl]amino]ethyl]-4-fluorobenzamide |
| SMILES | CN(C)Cc1nnc(NCCNC(=O)c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C14H18FN5O2/c1-20(2)9-12-18-19-14(22-12)17-8-7-16-13(21)10-3-5-11(15)6-4-10/h3-6H,7-9H2,1-2H3,(H,16,21)(H,17,19) |
| InChIKey | ZSBWXIMLVUCXTD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|