C12H15ClN4O — CID 137334336
(3R,8aS)-2-(5-chloropyrimidin-2-yl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137334336) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is (3R,8aS)-2-(5-chloropyrimidin-2-yl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aS)-2-(5-chloropyrimidin-2-yl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137334336 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (3R,8aS)-2-(5-chloropyrimidin-2-yl)-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@@H]1C(=O)N2CCC[C@H]2CN1c1ncc(Cl)cn1 |
| InChI | InChI=1S/C12H15ClN4O/c1-8-11(18)16-4-2-3-10(16)7-17(8)12-14-5-9(13)6-15-12/h5-6,8,10H,2-4,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | VCXPNNWGCPCITE-SCZZXKLOSA-N |
| XLogP | 1.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |