C14H19FN6O2 — CID 137334660
(7S,8aS)-7-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-2-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 137334660) has the molecular formula C14H19FN6O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is (7S,8aS)-7-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-2-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (7S,8aS)-7-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-2-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 137334660 |
| Molecular Formula | C14H19FN6O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (7S,8aS)-7-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]-2-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CN1CC(=O)N2C[C@@H](Nc3ncc(F)c(N(C)C)n3)C[C@H]2C1=O |
| InChI | InChI=1S/C14H19FN6O2/c1-19(2)12-9(15)5-16-14(18-12)17-8-4-10-13(23)20(3)7-11(22)21(10)6-8/h5,8,10H,4,6-7H2,1-3H3,(H,16,17,18)/t8-,10-/m0/s1 |
| InChIKey | DAFHVUSQBHGNPI-WPRPVWTQSA-N |
| XLogP | -0.46 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |