C16H26ClN5 — CID 137334881
5-chloro-2-methyl-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine (PubChem CID 137334881) has the molecular formula C16H26ClN5 and a molecular weight of 323.87 g/mol. Its IUPAC name is 5-chloro-2-methyl-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-methyl-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 137334881 |
| Molecular Formula | C16H26ClN5 |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 5-chloro-2-methyl-4-[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]pyrimidine |
| SMILES | Cc1ncc(Cl)c(N2CCCC(CN3CCN(C)CC3)C2)n1 |
| InChI | InChI=1S/C16H26ClN5/c1-13-18-10-15(17)16(19-13)22-5-3-4-14(12-22)11-21-8-6-20(2)7-9-21/h10,14H,3-9,11-12H2,1-2H3 |
| InChIKey | LVMUOAXIYPELGB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |