About 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol
1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol (PubChem CID 137335134) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol.
Molecular Properties
| Compound Name | 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol |
| PubChem CID | 137335134 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol |
| SMILES | Cc1ccc2[nH]c(CN3CCC(C(O)CO)CC3)c(C)c2c1 |
| InChI | InChI=1S/C18H26N2O2/c1-12-3-4-16-15(9-12)13(2)17(19-16)10-20-7-5-14(6-8-20)18(22)11-21/h3-4,9,14,18-19,21-22H,5-8,10-11H2,1-2H3 |
| InChIKey | RONRXONBPAFORV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol?
The IUPAC name of 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol (CID 137335134) is 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol.
What is the SMILES notation for 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol?
The canonical SMILES for 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol is Cc1ccc2[nH]c(CN3CCC(C(O)CO)CC3)c(C)c2c1.
What is the InChIKey of 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol?
The InChIKey is RONRXONBPAFORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O2/c1-12-3-4-16-15(9-12)13(2)17(19-16)10-20-7-5-14(6-8-20)18(22)11-21/h3-4,9,14,18-19,21-22H,5-8,10-11H2,1-2H3.
What are the key properties of 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol?
1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol has a molecular weight of 302.42 g/mol, XLogP of 2.35, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(3,5-dimethyl-1H-indol-2-yl)methyl]piperidin-4-yl]ethane-1,2-diol is sourced from PubChem (CID 137335134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).