C11H14ClN3O2 — CID 137335242
[3-(5-chloropyrimidin-2-yl)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanol (PubChem CID 137335242) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is [3-(5-chloropyrimidin-2-yl)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanol.
| Compound Name | [3-(5-chloropyrimidin-2-yl)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
|---|---|
| PubChem CID | 137335242 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | [3-(5-chloropyrimidin-2-yl)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
| SMILES | OCC1(CO)C2CN(c3ncc(Cl)cn3)CC21 |
| InChI | InChI=1S/C11H14ClN3O2/c12-7-1-13-10(14-2-7)15-3-8-9(4-15)11(8,5-16)6-17/h1-2,8-9,16-17H,3-6H2 |
| InChIKey | OKZABLNJYWEWTF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |