C20H34N2O3 — CID 137335522
[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(1-piperidin-1-ylcyclohexyl)methanone (PubChem CID 137335522) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(1-piperidin-1-ylcyclohexyl)methanone.
| Compound Name | [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(1-piperidin-1-ylcyclohexyl)methanone |
|---|---|
| PubChem CID | 137335522 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(1-piperidin-1-ylcyclohexyl)methanone |
| SMILES | O=C(N1C[C@@H]2COCC[C@]2(CO)C1)C1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C20H34N2O3/c23-16-19-9-12-25-14-17(19)13-21(15-19)18(24)20(7-3-1-4-8-20)22-10-5-2-6-11-22/h17,23H,1-16H2/t17-,19-/m1/s1 |
| InChIKey | ASABMXDGWDIYOJ-IEBWSBKVSA-N |
| XLogP | 2.03 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |