C20H25N3O3 — CID 137335812
[4-(1H-indole-5-carbonyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone (PubChem CID 137335812) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [4-(1H-indole-5-carbonyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone.
| Compound Name | [4-(1H-indole-5-carbonyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 137335812 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [4-(1H-indole-5-carbonyl)-1,4-diazepan-1-yl]-(oxan-4-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ccc2c1)N1CCCN(C(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C20H25N3O3/c24-19(15-5-12-26-13-6-15)22-8-1-9-23(11-10-22)20(25)17-2-3-18-16(14-17)4-7-21-18/h2-4,7,14-15,21H,1,5-6,8-13H2 |
| InChIKey | FQCFSICILGQNLP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |