C21H31N3O3 — CID 137336615
N-[(4R,5S)-5-hydroxy-4-methyl-9-(3-methylbut-2-enyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]pyridine-4-carboxamide (PubChem CID 137336615) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[(4R,5S)-5-hydroxy-4-methyl-9-(3-methylbut-2-enyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]pyridine-4-carboxamide.
| Compound Name | N-[(4R,5S)-5-hydroxy-4-methyl-9-(3-methylbut-2-enyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 137336615 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | N-[(4R,5S)-5-hydroxy-4-methyl-9-(3-methylbut-2-enyl)-1-oxa-9-azaspiro[5.5]undecan-4-yl]pyridine-4-carboxamide |
| SMILES | CC(C)=CCN1CCC2(CC1)OCC[C@@](C)(NC(=O)c1ccncc1)[C@@H]2O |
| InChI | InChI=1S/C21H31N3O3/c1-16(2)6-12-24-13-7-21(8-14-24)19(26)20(3,9-15-27-21)23-18(25)17-4-10-22-11-5-17/h4-6,10-11,19,26H,7-9,12-15H2,1-3H3,(H,23,25)/t19-,20+/m0/s1 |
| InChIKey | HOWVJPCFMBLJLL-VQTJNVASSA-N |
| XLogP | 2.15 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|