C17H23N5O3 — CID 137336941
2-N-[1-(cyclopentanecarbonyl)piperidin-4-yl]pyrazine-2,5-dicarboxamide (PubChem CID 137336941) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-N-[1-(cyclopentanecarbonyl)piperidin-4-yl]pyrazine-2,5-dicarboxamide.
| Compound Name | 2-N-[1-(cyclopentanecarbonyl)piperidin-4-yl]pyrazine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 137336941 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-N-[1-(cyclopentanecarbonyl)piperidin-4-yl]pyrazine-2,5-dicarboxamide |
| SMILES | NC(=O)c1cnc(C(=O)NC2CCN(C(=O)C3CCCC3)CC2)cn1 |
| InChI | InChI=1S/C17H23N5O3/c18-15(23)13-9-20-14(10-19-13)16(24)21-12-5-7-22(8-6-12)17(25)11-3-1-2-4-11/h9-12H,1-8H2,(H2,18,23)(H,21,24) |
| InChIKey | FFAOVYIXKVDRRJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |