About 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol
3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol (PubChem CID 137337000) has the molecular formula C17H21N3OS
and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol.
Molecular Properties
| Compound Name | 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol |
| PubChem CID | 137337000 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol |
| SMILES | Cc1nc(NC23CC4CC(CC(O)(C4)C2)C3)c2ccsc2n1 |
| InChI | InChI=1S/C17H21N3OS/c1-10-18-14(13-2-3-22-15(13)19-10)20-16-5-11-4-12(6-16)8-17(21,7-11)9-16/h2-3,11-12,21H,4-9H2,1H3,(H,18,19,20) |
| InChIKey | KHPVFQMPZUDLPV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol?
The IUPAC name of 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol (CID 137337000) is 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol.
What is the SMILES notation for 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol?
The canonical SMILES for 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol is Cc1nc(NC23CC4CC(CC(O)(C4)C2)C3)c2ccsc2n1.
What is the InChIKey of 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol?
The InChIKey is KHPVFQMPZUDLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3OS/c1-10-18-14(13-2-3-22-15(13)19-10)20-16-5-11-4-12(6-16)8-17(21,7-11)9-16/h2-3,11-12,21H,4-9H2,1H3,(H,18,19,20).
What are the key properties of 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol?
3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol has a molecular weight of 315.44 g/mol, XLogP of 3.50, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylthieno[2,3-d]pyrimidin-4-yl)amino]adamantan-1-ol is sourced from PubChem (CID 137337000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).