C20H27N3O2 — CID 137337753
[(3aR,7aR)-2-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137337753) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is [(3aR,7aR)-2-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137337753 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | [(3aR,7aR)-2-[(2,4-dimethyl-6-pyrazol-1-ylphenyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | Cc1cc(C)c(CN2C[C@@H]3COCC[C@]3(CO)C2)c(-n2cccn2)c1 |
| InChI | InChI=1S/C20H27N3O2/c1-15-8-16(2)18(19(9-15)23-6-3-5-21-23)11-22-10-17-12-25-7-4-20(17,13-22)14-24/h3,5-6,8-9,17,24H,4,7,10-14H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | HFGMIHNVKRHXMV-YLJYHZDGSA-N |
| XLogP | 2.32 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |