About [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone
[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone (PubChem CID 137337942) has the molecular formula C15H16FN3O2
and a molecular weight of 289.31 g/mol. Its IUPAC name is [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone |
| PubChem CID | 137337942 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone |
| SMILES | Cc1cc(C)n(C2CN(C(=O)c3ccc(F)c(O)c3)C2)n1 |
| InChI | InChI=1S/C15H16FN3O2/c1-9-5-10(2)19(17-9)12-7-18(8-12)15(21)11-3-4-13(16)14(20)6-11/h3-6,12,20H,7-8H2,1-2H3 |
| InChIKey | LGOPVYZVGIHBGB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone?
The IUPAC name of [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone (CID 137337942) is [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone.
What is the SMILES notation for [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone?
The canonical SMILES for [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone is Cc1cc(C)n(C2CN(C(=O)c3ccc(F)c(O)c3)C2)n1.
What is the InChIKey of [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone?
The InChIKey is LGOPVYZVGIHBGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN3O2/c1-9-5-10(2)19(17-9)12-7-18(8-12)15(21)11-3-4-13(16)14(20)6-11/h3-6,12,20H,7-8H2,1-2H3.
What are the key properties of [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone?
[3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone has a molecular weight of 289.31 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,5-dimethylpyrazol-1-yl)azetidin-1-yl]-(4-fluoro-3-hydroxyphenyl)methanone is sourced from PubChem (CID 137337942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).