C18H21ClN2O3 — CID 137338432
2-[[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]methyl]-6-chloro-1H-quinolin-4-one (PubChem CID 137338432) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]methyl]-6-chloro-1H-quinolin-4-one.
| Compound Name | 2-[[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]methyl]-6-chloro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 137338432 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]methyl]-6-chloro-1H-quinolin-4-one |
| SMILES | O=c1cc(CN2C[C@@H]3COCC[C@]3(CO)C2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H21ClN2O3/c19-13-1-2-16-15(5-13)17(23)6-14(20-16)8-21-7-12-9-24-4-3-18(12,10-21)11-22/h1-2,5-6,12,22H,3-4,7-11H2,(H,20,23)/t12-,18-/m1/s1 |
| InChIKey | JIXAQRPBVONARZ-KZULUSFZSA-N |
| XLogP | 2.01 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |